C28H25FN8O3 — CID 144865207
N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-5-fluoro-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide (PubChem CID 144865207) has the molecular formula C28H25FN8O3 and a molecular weight of 540.56 g/mol. Its IUPAC name is N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-5-fluoro-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide.
| Compound Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-5-fluoro-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 144865207 |
| Molecular Formula | C28H25FN8O3 |
| Molecular Weight | 540.56 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-5-fluoro-6-(1-methylpyrazol-4-yl)pyridine-2-carboxamide |
| SMILES | Cn1cc(-c2nc(C(=O)Nc3ccc4nn(CC(=O)NCCNC(=O)c5ccccc5)cc4c3)ccc2F)cn1 |
| InChI | InChI=1S/C28H25FN8O3/c1-36-15-20(14-32-36)26-22(29)8-10-24(34-26)28(40)33-21-7-9-23-19(13-21)16-37(35-23)17-25(38)30-11-12-31-27(39)18-5-3-2-4-6-18/h2-10,13-16H,11-12,17H2,1H3,(H,30,38)(H,31,39)(H,33,40) |
| InChIKey | CCOHKHNZRKFQOA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|