C24H22F3N7O2 — CID 123383131
N-[2-[2-oxo-2-[2-(pyridin-4-ylmethylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 123383131) has the molecular formula C24H22F3N7O2 and a molecular weight of 497.48 g/mol. Its IUPAC name is N-[2-[2-oxo-2-[2-(pyridin-4-ylmethylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-[2-oxo-2-[2-(pyridin-4-ylmethylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123383131 |
| Molecular Formula | C24H22F3N7O2 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[2-[2-oxo-2-[2-(pyridin-4-ylmethylamino)ethylamino]ethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(Cn1cc2cc(NC(=O)c3cccc(C(F)(F)F)n3)ccc2n1)NCCNCc1ccncc1 |
| InChI | InChI=1S/C24H22F3N7O2/c25-24(26,27)21-3-1-2-20(32-21)23(36)31-18-4-5-19-17(12-18)14-34(33-19)15-22(35)30-11-10-29-13-16-6-8-28-9-7-16/h1-9,12,14,29H,10-11,13,15H2,(H,30,35)(H,31,36) |
| InChIKey | MKNAGVLXEGAMTO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|