C25H20ClF3N6O3 — CID 134422929
N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]-6-chloroindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 134422929) has the molecular formula C25H20ClF3N6O3 and a molecular weight of 544.92 g/mol. Its IUPAC name is N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]-6-chloroindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]-6-chloroindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134422929 |
| Molecular Formula | C25H20ClF3N6O3 |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]-6-chloroindazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(Cn1cc2cc(NC(=O)c3cccc(C(F)(F)F)n3)c(Cl)cc2n1)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20ClF3N6O3/c26-17-12-19-16(11-20(17)33-24(38)18-7-4-8-21(32-18)25(27,28)29)13-35(34-19)14-22(36)30-9-10-31-23(37)15-5-2-1-3-6-15/h1-8,11-13H,9-10,14H2,(H,30,36)(H,31,37)(H,33,38) |
| InChIKey | OHGWEINSEQJWII-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|