C23H19F3N6O3S — CID 134422945
N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-4-(trifluoromethyl)-1,3-thiazole-2-carboxamide (PubChem CID 134422945) has the molecular formula C23H19F3N6O3S and a molecular weight of 516.51 g/mol. Its IUPAC name is N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-4-(trifluoromethyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-4-(trifluoromethyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 134422945 |
| Molecular Formula | C23H19F3N6O3S |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | N-[2-[2-(2-benzamidoethylamino)-2-oxoethyl]indazol-5-yl]-4-(trifluoromethyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(Cn1cc2cc(NC(=O)c3nc(C(F)(F)F)cs3)ccc2n1)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19F3N6O3S/c24-23(25,26)18-13-36-22(30-18)21(35)29-16-6-7-17-15(10-16)11-32(31-17)12-19(33)27-8-9-28-20(34)14-4-2-1-3-5-14/h1-7,10-11,13H,8-9,12H2,(H,27,33)(H,28,34)(H,29,35) |
| InChIKey | ARDBCKQOFQHXCK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|