C18H19BrN6O2 — CID 123830920
6-bromo-N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]pyridine-2-carboxamide (PubChem CID 123830920) has the molecular formula C18H19BrN6O2 and a molecular weight of 431.29 g/mol. Its IUPAC name is 6-bromo-N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123830920 |
| Molecular Formula | C18H19BrN6O2 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 6-bromo-N-[2-[2-[2-(methylamino)ethylamino]-2-oxoethyl]indazol-5-yl]pyridine-2-carboxamide |
| SMILES | CNCCNC(=O)Cn1cc2cc(NC(=O)c3cccc(Br)n3)ccc2n1 |
| InChI | InChI=1S/C18H19BrN6O2/c1-20-7-8-21-17(26)11-25-10-12-9-13(5-6-14(12)24-25)22-18(27)15-3-2-4-16(19)23-15/h2-6,9-10,20H,7-8,11H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | WOQXZARFFMAEEP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|