C24H26N4O2 — CID 134557942
N-hydroxy-4-[1-(2-methyl-N-propan-2-yl-4-pyridin-3-ylanilino)ethenylamino]benzamide (PubChem CID 134557942) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-hydroxy-4-[1-(2-methyl-N-propan-2-yl-4-pyridin-3-ylanilino)ethenylamino]benzamide.
| Compound Name | N-hydroxy-4-[1-(2-methyl-N-propan-2-yl-4-pyridin-3-ylanilino)ethenylamino]benzamide |
|---|---|
| PubChem CID | 134557942 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-hydroxy-4-[1-(2-methyl-N-propan-2-yl-4-pyridin-3-ylanilino)ethenylamino]benzamide |
| SMILES | C=C(Nc1ccc(C(=O)NO)cc1)N(c1ccc(-c2cccnc2)cc1C)C(C)C |
| InChI | InChI=1S/C24H26N4O2/c1-16(2)28(18(4)26-22-10-7-19(8-11-22)24(29)27-30)23-12-9-20(14-17(23)3)21-6-5-13-25-15-21/h5-16,26,30H,4H2,1-3H3,(H,27,29) |
| InChIKey | QPUFQONDMXFVSU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|