C16H22N2O — CID 134560753
2,4,9,9,9a-pentamethyl-3aH-furo[3,2-b]quinolin-3-amine (PubChem CID 134560753) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2,4,9,9,9a-pentamethyl-3aH-furo[3,2-b]quinolin-3-amine.
| Compound Name | 2,4,9,9,9a-pentamethyl-3aH-furo[3,2-b]quinolin-3-amine |
|---|---|
| PubChem CID | 134560753 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2,4,9,9,9a-pentamethyl-3aH-furo[3,2-b]quinolin-3-amine |
| SMILES | CC1=C(N)C2N(C)c3ccccc3C(C)(C)C2(C)O1 |
| InChI | InChI=1S/C16H22N2O/c1-10-13(17)14-16(4,19-10)15(2,3)11-8-6-7-9-12(11)18(14)5/h6-9,14H,17H2,1-5H3 |
| InChIKey | DYHNQEYZTSLOPZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |