C24H31N3O — CID 134563679
2-[2-oxo-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-ylidene]acetonitrile (PubChem CID 134563679) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-[2-oxo-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-ylidene]acetonitrile.
| Compound Name | 2-[2-oxo-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-ylidene]acetonitrile |
|---|---|
| PubChem CID | 134563679 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2-[2-oxo-1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-ylidene]acetonitrile |
| SMILES | CC(C)C1CCC(N2CCC(N3C(=O)C(=CC#N)c4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C24H31N3O/c1-17(2)18-7-9-19(10-8-18)26-15-12-20(13-16-26)27-23-6-4-3-5-21(23)22(11-14-25)24(27)28/h3-6,11,17-20H,7-10,12-13,15-16H2,1-2H3 |
| InChIKey | DKHNJTMKIAYTSG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|