C20H33NO7S2 — CID 134565057
2-[2-[2-(disulfanyl)propan-2-ylamino]-4-[(2-methylpropan-2-yl)oxymethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 134565057) has the molecular formula C20H33NO7S2 and a molecular weight of 463.62 g/mol. Its IUPAC name is 2-[2-[2-(disulfanyl)propan-2-ylamino]-4-[(2-methylpropan-2-yl)oxymethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[2-[2-(disulfanyl)propan-2-ylamino]-4-[(2-methylpropan-2-yl)oxymethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134565057 |
| Molecular Formula | C20H33NO7S2 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 2-[2-[2-(disulfanyl)propan-2-ylamino]-4-[(2-methylpropan-2-yl)oxymethyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)(C)OCc1ccc(OC2OC(CO)C(O)C(O)C2O)c(NC(C)(C)SS)c1 |
| InChI | InChI=1S/C20H33NO7S2/c1-19(2,3)26-10-11-6-7-13(12(8-11)21-20(4,5)30-29)27-18-17(25)16(24)15(23)14(9-22)28-18/h6-8,14-18,21-25,29H,9-10H2,1-5H3 |
| InChIKey | HMBCUDMXGLVDKY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|