C8H14N2 — CID 134566819
1,2,6-trimethyl-2,5-dihydro-1,3-diazepine (PubChem CID 134566819) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,2,6-trimethyl-2,5-dihydro-1,3-diazepine.
| Compound Name | 1,2,6-trimethyl-2,5-dihydro-1,3-diazepine |
|---|---|
| PubChem CID | 134566819 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1,2,6-trimethyl-2,5-dihydro-1,3-diazepine |
| SMILES | CC1=CN(C)C(C)N=CC1 |
| InChI | InChI=1S/C8H14N2/c1-7-4-5-9-8(2)10(3)6-7/h5-6,8H,4H2,1-3H3 |
| InChIKey | RFINDGAAKJJQGR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |