C19H26N4O — CID 134567033
4-amino-3-(1-aminoethyl)-N-(3-methyl-1-pyridin-2-ylbutyl)benzamide (PubChem CID 134567033) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-amino-3-(1-aminoethyl)-N-(3-methyl-1-pyridin-2-ylbutyl)benzamide.
| Compound Name | 4-amino-3-(1-aminoethyl)-N-(3-methyl-1-pyridin-2-ylbutyl)benzamide |
|---|---|
| PubChem CID | 134567033 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 4-amino-3-(1-aminoethyl)-N-(3-methyl-1-pyridin-2-ylbutyl)benzamide |
| SMILES | CC(C)CC(NC(=O)c1ccc(N)c(C(C)N)c1)c1ccccn1 |
| InChI | InChI=1S/C19H26N4O/c1-12(2)10-18(17-6-4-5-9-22-17)23-19(24)14-7-8-16(21)15(11-14)13(3)20/h4-9,11-13,18H,10,20-21H2,1-3H3,(H,23,24) |
| InChIKey | NHOIASVBVIDCBL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|