C32H37N3O2 — CID 134567175
N-benzyl-3-[4-[3-(3-hydroxy-5-methylcycloheptyl)propyl]phenyl]-1H-indazole-5-carboxamide (PubChem CID 134567175) has the molecular formula C32H37N3O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-benzyl-3-[4-[3-(3-hydroxy-5-methylcycloheptyl)propyl]phenyl]-1H-indazole-5-carboxamide.
| Compound Name | N-benzyl-3-[4-[3-(3-hydroxy-5-methylcycloheptyl)propyl]phenyl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 134567175 |
| Molecular Formula | C32H37N3O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | N-benzyl-3-[4-[3-(3-hydroxy-5-methylcycloheptyl)propyl]phenyl]-1H-indazole-5-carboxamide |
| SMILES | CC1CCC(CCCc2ccc(-c3n[nH]c4ccc(C(=O)NCc5ccccc5)cc34)cc2)CC(O)C1 |
| InChI | InChI=1S/C32H37N3O2/c1-22-10-11-24(19-28(36)18-22)9-5-8-23-12-14-26(15-13-23)31-29-20-27(16-17-30(29)34-35-31)32(37)33-21-25-6-3-2-4-7-25/h2-4,6-7,12-17,20,22,24,28,36H,5,8-11,18-19,21H2,1H3,(H,33,37)(H,34,35) |
| InChIKey | APVGWFNCPNEQDR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |