C20H31N5O — CID 134567416
4-amino-3-ethanimidoyl-N-[[1-(4-methylpiperazin-1-yl)cyclopentyl]methyl]benzamide (PubChem CID 134567416) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is 4-amino-3-ethanimidoyl-N-[[1-(4-methylpiperazin-1-yl)cyclopentyl]methyl]benzamide.
| Compound Name | 4-amino-3-ethanimidoyl-N-[[1-(4-methylpiperazin-1-yl)cyclopentyl]methyl]benzamide |
|---|---|
| PubChem CID | 134567416 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 4-amino-3-ethanimidoyl-N-[[1-(4-methylpiperazin-1-yl)cyclopentyl]methyl]benzamide |
| SMILES | [H]/N=C(\C)c1cc(C(=O)NCC2(N3CCN(C)CC3)CCCC2)ccc1N |
| InChI | InChI=1S/C20H31N5O/c1-15(21)17-13-16(5-6-18(17)22)19(26)23-14-20(7-3-4-8-20)25-11-9-24(2)10-12-25/h5-6,13,21H,3-4,7-12,14,22H2,1-2H3,(H,23,26)/b21-15+ |
| InChIKey | CDHFMIHCBWHNGR-RCCKNPSSSA-N |
| XLogP | 1.95 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|