C12H21N3O — CID 134567937
ethyl (E)-3-[[amino(cyclopropylidene)methyl]amino]-N,2-dimethylbut-2-enimidate (PubChem CID 134567937) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is ethyl (E)-3-[[amino(cyclopropylidene)methyl]amino]-N,2-dimethylbut-2-enimidate.
| Compound Name | ethyl (E)-3-[[amino(cyclopropylidene)methyl]amino]-N,2-dimethylbut-2-enimidate |
|---|---|
| PubChem CID | 134567937 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | ethyl (E)-3-[[amino(cyclopropylidene)methyl]amino]-N,2-dimethylbut-2-enimidate |
| SMILES | CCOC(=N\C)/C(C)=C(\C)NC(N)=C1CC1 |
| InChI | InChI=1S/C12H21N3O/c1-5-16-12(14-4)8(2)9(3)15-11(13)10-6-7-10/h15H,5-7,13H2,1-4H3/b9-8+,14-12- |
| InChIKey | JLTKLAVCGQOHPY-BYKJOZEVSA-N |
| XLogP | 1.90 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|