About ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane
ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane (PubChem CID 170618775) has the molecular formula C13H30N2O
and a molecular weight of 230.40 g/mol. Its IUPAC name is ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane.
Molecular Properties
| Compound Name | ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane |
| PubChem CID | 170618775 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane |
| SMILES | CC.CCC.CCO/C(N)=C(C)/C(C)=N/C |
| InChI | InChI=1S/C8H16N2O.C3H8.C2H6/c1-5-11-8(9)6(2)7(3)10-4;1-3-2;1-2/h5,9H2,1-4H3;3H2,1-2H3;1-2H3/b8-6+,10-7+;; |
| InChIKey | NXCFHCVEDXTLBO-VZHDLXMVSA-N |
| XLogP | 3.75 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane?
The IUPAC name of ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane (CID 170618775) is ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane.
What is the SMILES notation for ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane?
The canonical SMILES for ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane is CC.CCC.CCO/C(N)=C(C)/C(C)=N/C.
What is the InChIKey of ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane?
The InChIKey is NXCFHCVEDXTLBO-VZHDLXMVSA-N. The full InChI is InChI=1S/C8H16N2O.C3H8.C2H6/c1-5-11-8(9)6(2)7(3)10-4;1-3-2;1-2/h5,9H2,1-4H3;3H2,1-2H3;1-2H3/b8-6+,10-7+;;.
What are the key properties of ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane?
ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane has a molecular weight of 230.40 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-1-ethoxy-2-methyl-3-methyliminobut-1-en-1-amine;propane is sourced from PubChem (CID 170618775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).