C21H20ClF2NO4S — CID 134568725
methyl 4-[(3-chloro-4-fluoro-N-(1-oxothiane-4-carbonyl)anilino)methyl]-3-fluorobenzoate (PubChem CID 134568725) has the molecular formula C21H20ClF2NO4S and a molecular weight of 455.91 g/mol. Its IUPAC name is methyl 4-[(3-chloro-4-fluoro-N-(1-oxothiane-4-carbonyl)anilino)methyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[(3-chloro-4-fluoro-N-(1-oxothiane-4-carbonyl)anilino)methyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 134568725 |
| Molecular Formula | C21H20ClF2NO4S |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | methyl 4-[(3-chloro-4-fluoro-N-(1-oxothiane-4-carbonyl)anilino)methyl]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)C2CCS(=O)CC2)c2ccc(F)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C21H20ClF2NO4S/c1-29-21(27)14-2-3-15(19(24)10-14)12-25(16-4-5-18(23)17(22)11-16)20(26)13-6-8-30(28)9-7-13/h2-5,10-11,13H,6-9,12H2,1H3 |
| InChIKey | RHUUYLWSTGRSBA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |