C57H38N4S — CID 134569549
9-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-2-yl]phenyl]-2,7-diphenylcarbazole (PubChem CID 134569549) has the molecular formula C57H38N4S and a molecular weight of 811.03 g/mol. Its IUPAC name is 9-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-2-yl]phenyl]-2,7-diphenylcarbazole.
| Compound Name | 9-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-2-yl]phenyl]-2,7-diphenylcarbazole |
|---|---|
| PubChem CID | 134569549 |
| Molecular Formula | C57H38N4S |
| Molecular Weight | 811.03 g/mol |
| Exact Mass | 810.28 |
| IUPAC Name | 9-[3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-2-yl]phenyl]-2,7-diphenylcarbazole |
| SMILES | C1=c2sc3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-c4cccc(-n5c6cc(-c7ccccc7)ccc6c6ccc(-c7ccccc7)cc65)c4)cc3c2=CCC1 |
| InChI | InChI=1S/C57H38N4S/c1-5-16-37(17-6-1)42-28-30-46-47-31-29-43(38-18-7-2-8-19-38)36-52(47)61(51(46)35-42)45-25-15-24-41(32-45)44-33-49-48-26-13-14-27-53(48)62-54(49)50(34-44)57-59-55(39-20-9-3-10-21-39)58-56(60-57)40-22-11-4-12-23-40/h1-12,15-36H,13-14H2 |
| InChIKey | LOPOMPDDWYXTOU-UHFFFAOYSA-N |
| XLogP | 13.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.03 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |