C54H35N7S — CID 155328672
9-[4-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 155328672) has the molecular formula C54H35N7S and a molecular weight of 813.99 g/mol. Its IUPAC name is 9-[4-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 9-[4-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 155328672 |
| Molecular Formula | C54H35N7S |
| Molecular Weight | 813.99 g/mol |
| Exact Mass | 813.27 |
| IUPAC Name | 9-[4-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7,8-dihydrodibenzothiophen-4-yl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | C1=c2sc3c(-c4nc(-c5ccccc5)nc(-c5ccc(-n6c7ccccc7c7ccccc76)cc5)n4)cccc3c2=C(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C54H35N7S/c1-4-16-34(17-5-1)49-55-50(35-18-6-2-7-19-35)58-53(57-49)42-25-15-29-46-47(42)41-24-14-26-43(48(41)62-46)54-59-51(36-20-8-3-9-21-36)56-52(60-54)37-30-32-38(33-31-37)61-44-27-12-10-22-39(44)40-23-11-13-28-45(40)61/h1-14,16-24,26-33H,15,25H2 |
| InChIKey | GCYOZSFUMCDJIW-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.99 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |