C18H21F2N3OS — CID 134569835
N-[5-(2,2-difluoropropylsulfinyl)-2,4-dimethylphenyl]-N'-methylpyridine-3-carboximidamide (PubChem CID 134569835) has the molecular formula C18H21F2N3OS and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[5-(2,2-difluoropropylsulfinyl)-2,4-dimethylphenyl]-N'-methylpyridine-3-carboximidamide.
| Compound Name | N-[5-(2,2-difluoropropylsulfinyl)-2,4-dimethylphenyl]-N'-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 134569835 |
| Molecular Formula | C18H21F2N3OS |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[5-(2,2-difluoropropylsulfinyl)-2,4-dimethylphenyl]-N'-methylpyridine-3-carboximidamide |
| SMILES | C/N=C(/Nc1cc(S(=O)CC(C)(F)F)c(C)cc1C)c1cccnc1 |
| InChI | InChI=1S/C18H21F2N3OS/c1-12-8-13(2)16(25(24)11-18(3,19)20)9-15(12)23-17(21-4)14-6-5-7-22-10-14/h5-10H,11H2,1-4H3,(H,21,23) |
| InChIKey | WWRUENCBEKKIRS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|