C16H16O4 — CID 134570399
(3S,5S,6R)-2-[2-(4-ethynylphenyl)ethynyl]-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 134570399) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3S,5S,6R)-2-[2-(4-ethynylphenyl)ethynyl]-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (3S,5S,6R)-2-[2-(4-ethynylphenyl)ethynyl]-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 134570399 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (3S,5S,6R)-2-[2-(4-ethynylphenyl)ethynyl]-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | C#Cc1ccc(C#CC2O[C@H](CO)[C@@H](O)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H16O4/c1-2-11-3-5-12(6-4-11)7-8-15-13(18)9-14(19)16(10-17)20-15/h1,3-6,13-19H,9-10H2/t13-,14-,15?,16+/m0/s1 |
| InChIKey | LYSVGDBKLVEAKP-FCMBSTCGSA-N |
| XLogP | -0.11 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|