C31H36O10 — CID 144652743
(2R,3S,6R)-2-(hydroxymethyl)-6-[2-[4-[2-[4-[2-[(2R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]propan-2-yl]phenyl]ethynyl]oxane-3,4,5-triol (PubChem CID 144652743) has the molecular formula C31H36O10 and a molecular weight of 568.62 g/mol. Its IUPAC name is (2R,3S,6R)-2-(hydroxymethyl)-6-[2-[4-[2-[4-[2-[(2R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]propan-2-yl]phenyl]ethynyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,6R)-2-(hydroxymethyl)-6-[2-[4-[2-[4-[2-[(2R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]propan-2-yl]phenyl]ethynyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 144652743 |
| Molecular Formula | C31H36O10 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | (2R,3S,6R)-2-(hydroxymethyl)-6-[2-[4-[2-[4-[2-[(2R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]propan-2-yl]phenyl]ethynyl]oxane-3,4,5-triol |
| SMILES | CC(C)(c1ccc(C#C[C@H]2O[C@H](CO)[C@@H](O)C(O)C2O)cc1)c1ccc(C#C[C@H]2O[C@H](CO)[C@@H](O)C(O)C2O)cc1 |
| InChI | InChI=1S/C31H36O10/c1-31(2,19-9-3-17(4-10-19)7-13-21-25(34)29(38)27(36)23(15-32)40-21)20-11-5-18(6-12-20)8-14-22-26(35)30(39)28(37)24(16-33)41-22/h3-6,9-12,21-30,32-39H,15-16H2,1-2H3/t21-,22-,23-,24-,25?,26?,27-,28-,29?,30?/m1/s1 |
| InChIKey | VJDWVRDEOXVPKY-IPIWFWTESA-N |
| XLogP | -1.60 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|