C19H20O5 — CID 123297562
2-(hydroxymethyl)-6-[2-(7-methylnaphthalen-2-yl)ethynyl]oxane-3,4,5-triol (PubChem CID 123297562) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[2-(7-methylnaphthalen-2-yl)ethynyl]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[2-(7-methylnaphthalen-2-yl)ethynyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123297562 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-(hydroxymethyl)-6-[2-(7-methylnaphthalen-2-yl)ethynyl]oxane-3,4,5-triol |
| SMILES | Cc1ccc2ccc(C#CC3OC(CO)C(O)C(O)C3O)cc2c1 |
| InChI | InChI=1S/C19H20O5/c1-11-2-5-13-6-3-12(9-14(13)8-11)4-7-15-17(21)19(23)18(22)16(10-20)24-15/h2-3,5-6,8-9,15-23H,10H2,1H3 |
| InChIKey | UXNQDXDNOVXWIT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|