C28H32O6 — CID 155076028
(2R,3S,4R,5S,6R)-2-[2-(1-hydroxy-1,7'-dimethylspiro[cyclohexane-4,9'-fluorene]-2'-yl)ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 155076028) has the molecular formula C28H32O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-2-[2-(1-hydroxy-1,7'-dimethylspiro[cyclohexane-4,9'-fluorene]-2'-yl)ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5S,6R)-2-[2-(1-hydroxy-1,7'-dimethylspiro[cyclohexane-4,9'-fluorene]-2'-yl)ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 155076028 |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (2R,3S,4R,5S,6R)-2-[2-(1-hydroxy-1,7'-dimethylspiro[cyclohexane-4,9'-fluorene]-2'-yl)ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc2c(c1)C1(CCC(C)(O)CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-2 |
| InChI | InChI=1S/C28H32O6/c1-16-3-6-18-19-7-4-17(5-8-22-24(30)26(32)25(31)23(15-29)34-22)14-21(19)28(20(18)13-16)11-9-27(2,33)10-12-28/h3-4,6-7,13-14,22-26,29-33H,9-12,15H2,1-2H3/t22-,23-,24-,25-,26-,27?,28?/m1/s1 |
| InChIKey | CXIAMKPMHOZCGK-WTEBGUTGSA-N |
| XLogP | 1.78 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|