C37H50O8 — CID 67248833
4-[7-(3-hydroxy-3-methylbut-1-ynyl)-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]-2-methylbut-3-yn-2-ol (PubChem CID 67248833) has the molecular formula C37H50O8 and a molecular weight of 622.80 g/mol. Its IUPAC name is 4-[7-(3-hydroxy-3-methylbut-1-ynyl)-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[7-(3-hydroxy-3-methylbut-1-ynyl)-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 67248833 |
| Molecular Formula | C37H50O8 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.35 |
| IUPAC Name | 4-[7-(3-hydroxy-3-methylbut-1-ynyl)-9,9-bis[2-[2-(2-methoxyethoxy)ethoxy]ethyl]fluoren-2-yl]-2-methylbut-3-yn-2-ol |
| SMILES | COCCOCCOCCC1(CCOCCOCCOC)c2cc(C#CC(C)(C)O)ccc2-c2ccc(C#CC(C)(C)O)cc21 |
| InChI | InChI=1S/C37H50O8/c1-35(2,38)13-11-29-7-9-31-32-10-8-30(12-14-36(3,4)39)28-34(32)37(33(31)27-29,15-17-42-23-25-44-21-19-40-5)16-18-43-24-26-45-22-20-41-6/h7-10,27-28,38-39H,15-26H2,1-6H3 |
| InChIKey | VYMKCYLTWJFFQF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|