C30H30F2O10 — CID 126704230
(2R,3S,4S,5S,6R)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(2-hydroxyethyl)oxane-3,4,5-triol (PubChem CID 126704230) has the molecular formula C30H30F2O10 and a molecular weight of 588.56 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(2-hydroxyethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(2-hydroxyethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 126704230 |
| Molecular Formula | C30H30F2O10 |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[2-[9,9-difluoro-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]fluoren-2-yl]ethynyl]-6-(2-hydroxyethyl)oxane-3,4,5-triol |
| SMILES | OCC[C@H]1O[C@H](C#Cc2ccc3c(c2)C(F)(F)c2cc(C#C[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)ccc2-3)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H30F2O10/c31-30(32)18-11-14(3-7-20-24(35)28(39)26(37)22(41-20)9-10-33)1-5-16(18)17-6-2-15(12-19(17)30)4-8-21-25(36)29(40)27(38)23(13-34)42-21/h1-2,5-6,11-12,20-29,33-40H,9-10,13H2/t20-,21-,22-,23-,24-,25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | GVQKLOUEVXCFKA-VEDGSLNGSA-N |
| XLogP | -1.41 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|