C26H31F3O5 — CID 130226571
2-[4-ethyl-7-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-2,3-dihydro-1H-inden-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 130226571) has the molecular formula C26H31F3O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-[4-ethyl-7-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-2,3-dihydro-1H-inden-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[4-ethyl-7-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-2,3-dihydro-1H-inden-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 130226571 |
| Molecular Formula | C26H31F3O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 2-[4-ethyl-7-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-2,3-dihydro-1H-inden-5-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1c(C2OC(CO)C(O)C(O)C2O)cc(Cc2ccc(CC(F)(F)F)cc2)c2c1CCC2 |
| InChI | InChI=1S/C26H31F3O5/c1-2-17-19-5-3-4-18(19)16(10-14-6-8-15(9-7-14)12-26(27,28)29)11-20(17)25-24(33)23(32)22(31)21(13-30)34-25/h6-9,11,21-25,30-33H,2-5,10,12-13H2,1H3 |
| InChIKey | BLYZIWCGSHKDNW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |