C30H32F2O10 — CID 144652791
(5S)-2-[2-[3-(fluoromethyl)-4-[2-(fluoromethyl)-4-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]phenyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 144652791) has the molecular formula C30H32F2O10 and a molecular weight of 590.57 g/mol. Its IUPAC name is (5S)-2-[2-[3-(fluoromethyl)-4-[2-(fluoromethyl)-4-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]phenyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (5S)-2-[2-[3-(fluoromethyl)-4-[2-(fluoromethyl)-4-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]phenyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 144652791 |
| Molecular Formula | C30H32F2O10 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | (5S)-2-[2-[3-(fluoromethyl)-4-[2-(fluoromethyl)-4-[2-[(5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]phenyl]phenyl]ethynyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OCC1OC(C#Cc2ccc(-c3ccc(C#CC4OC(CO)[C@@H](O)C(O)C4O)cc3CF)c(CF)c2)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C30H32F2O10/c31-11-17-9-15(3-7-21-25(35)29(39)27(37)23(13-33)41-21)1-5-19(17)20-6-2-16(10-18(20)12-32)4-8-22-26(36)30(40)28(38)24(14-34)42-22/h1-2,5-6,9-10,21-30,33-40H,11-14H2/t21?,22?,23?,24?,25?,26?,27-,28-,29?,30?/m1/s1 |
| InChIKey | MVYYJPIXUCOACO-CVTGTYQYSA-N |
| XLogP | -1.32 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|