C56H35N5O — CID 134571377
2,4-bis(3-pyridin-3-ylphenyl)-6-spiro[tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene-14,9'-xanthene]-11-yl-1,3,5-triazine (PubChem CID 134571377) has the molecular formula C56H35N5O and a molecular weight of 793.93 g/mol. Its IUPAC name is 2,4-bis(3-pyridin-3-ylphenyl)-6-spiro[tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene-14,9'-xanthene]-11-yl-1,3,5-triazine.
| Compound Name | 2,4-bis(3-pyridin-3-ylphenyl)-6-spiro[tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene-14,9'-xanthene]-11-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 134571377 |
| Molecular Formula | C56H35N5O |
| Molecular Weight | 793.93 g/mol |
| Exact Mass | 793.28 |
| IUPAC Name | 2,4-bis(3-pyridin-3-ylphenyl)-6-spiro[tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene-14,9'-xanthene]-11-yl-1,3,5-triazine |
| SMILES | c1cncc(-c2cccc(-c3nc(-c4cccc(-c5cccnc5)c4)nc(-c4ccc5c(c4)C4(c6ccccc6Oc6ccccc64)c4ccccc4-c4ccccc4-5)n3)c2)c1 |
| InChI | InChI=1S/C56H35N5O/c1-2-20-44-43(19-1)45-21-3-4-22-47(45)56(48-23-5-7-25-51(48)62-52-26-8-6-24-49(52)56)50-33-40(27-28-46(44)50)55-60-53(38-15-9-13-36(31-38)41-17-11-29-57-34-41)59-54(61-55)39-16-10-14-37(32-39)42-18-12-30-58-35-42/h1-35H |
| InChIKey | XXINBNKLCRSNRF-UHFFFAOYSA-N |
| XLogP | 13.13 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.93 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |