C25H36N8O3S — CID 134572323
2-[2-amino-5-[[2-methoxy-5-(2H-tetrazol-5-ylmethyl)phenyl]methyl]-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-4-yl]ethyl formate (PubChem CID 134572323) has the molecular formula C25H36N8O3S and a molecular weight of 528.68 g/mol. Its IUPAC name is 2-[2-amino-5-[[2-methoxy-5-(2H-tetrazol-5-ylmethyl)phenyl]methyl]-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-4-yl]ethyl formate.
| Compound Name | 2-[2-amino-5-[[2-methoxy-5-(2H-tetrazol-5-ylmethyl)phenyl]methyl]-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-4-yl]ethyl formate |
|---|---|
| PubChem CID | 134572323 |
| Molecular Formula | C25H36N8O3S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | 2-[2-amino-5-[[2-methoxy-5-(2H-tetrazol-5-ylmethyl)phenyl]methyl]-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-4-yl]ethyl formate |
| SMILES | CCCC[C@@H](CCSC)Nc1nc(N)nc(CCOC=O)c1Cc1cc(Cc2nn[nH]n2)ccc1OC |
| InChI | InChI=1S/C25H36N8O3S/c1-4-5-6-19(10-12-37-3)27-24-20(21(9-11-36-16-34)28-25(26)29-24)15-18-13-17(7-8-22(18)35-2)14-23-30-32-33-31-23/h7-8,13,16,19H,4-6,9-12,14-15H2,1-3H3,(H3,26,27,28,29)(H,30,31,32,33)/t19-/m0/s1 |
| InChIKey | NKQJAVQWZQNLLE-IBGZPJMESA-N |
| XLogP | 3.20 |
| TPSA | 153.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|