C27H44N5O3PS — CID 134572397
3-[[2-amino-4-methyl-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-5-yl]methyl]-N-(3-dimethylphosphorylpropyl)-4-methoxybenzamide (PubChem CID 134572397) has the molecular formula C27H44N5O3PS and a molecular weight of 549.72 g/mol. Its IUPAC name is 3-[[2-amino-4-methyl-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-5-yl]methyl]-N-(3-dimethylphosphorylpropyl)-4-methoxybenzamide.
| Compound Name | 3-[[2-amino-4-methyl-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-5-yl]methyl]-N-(3-dimethylphosphorylpropyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 134572397 |
| Molecular Formula | C27H44N5O3PS |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.29 |
| IUPAC Name | 3-[[2-amino-4-methyl-6-[[(3S)-1-methylsulfanylheptan-3-yl]amino]pyrimidin-5-yl]methyl]-N-(3-dimethylphosphorylpropyl)-4-methoxybenzamide |
| SMILES | CCCC[C@@H](CCSC)Nc1nc(N)nc(C)c1Cc1cc(C(=O)NCCCP(C)(C)=O)ccc1OC |
| InChI | InChI=1S/C27H44N5O3PS/c1-7-8-10-22(13-16-37-6)31-25-23(19(2)30-27(28)32-25)18-21-17-20(11-12-24(21)35-3)26(33)29-14-9-15-36(4,5)34/h11-12,17,22H,7-10,13-16,18H2,1-6H3,(H,29,33)(H3,28,30,31,32)/t22-/m0/s1 |
| InChIKey | FNDANBHTAKISQS-QFIPXVFZSA-N |
| XLogP | 5.43 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|