C26H42N4O4 — CID 67614917
3-[4-[[2-amino-4-[[(3S)-1-butoxyhexan-3-yl]amino]-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenoxy]propan-1-ol (PubChem CID 67614917) has the molecular formula C26H42N4O4 and a molecular weight of 474.65 g/mol. Its IUPAC name is 3-[4-[[2-amino-4-[[(3S)-1-butoxyhexan-3-yl]amino]-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenoxy]propan-1-ol.
| Compound Name | 3-[4-[[2-amino-4-[[(3S)-1-butoxyhexan-3-yl]amino]-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenoxy]propan-1-ol |
|---|---|
| PubChem CID | 67614917 |
| Molecular Formula | C26H42N4O4 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 3-[4-[[2-amino-4-[[(3S)-1-butoxyhexan-3-yl]amino]-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenoxy]propan-1-ol |
| SMILES | CCCCOCC[C@H](CCC)Nc1nc(N)nc(C)c1Cc1ccc(OCCCO)cc1OC |
| InChI | InChI=1S/C26H42N4O4/c1-5-7-14-33-16-12-21(9-6-2)29-25-23(19(3)28-26(27)30-25)17-20-10-11-22(18-24(20)32-4)34-15-8-13-31/h10-11,18,21,31H,5-9,12-17H2,1-4H3,(H3,27,28,29,30)/t21-/m0/s1 |
| InChIKey | ZNDWACVTLIQQOB-NRFANRHFSA-N |
| XLogP | 4.52 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|