C22H32N4O4 — CID 42613817
3-hydroxypropyl 2-[4-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenyl]acetate (PubChem CID 42613817) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-hydroxypropyl 2-[4-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenyl]acetate.
| Compound Name | 3-hydroxypropyl 2-[4-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 42613817 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 3-hydroxypropyl 2-[4-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-3-methoxyphenyl]acetate |
| SMILES | CCCCNc1nc(N)nc(C)c1Cc1ccc(CC(=O)OCCCO)cc1OC |
| InChI | InChI=1S/C22H32N4O4/c1-4-5-9-24-21-18(15(2)25-22(23)26-21)14-17-8-7-16(12-19(17)29-3)13-20(28)30-11-6-10-27/h7-8,12,27H,4-6,9-11,13-14H2,1-3H3,(H3,23,24,25,26) |
| InChIKey | HJEDJKUWIHVYHM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|