C31H43Cl2N5O5S — CID 87453472
2,5-dichlorobenzenesulfonic acid;4-(dimethylamino)butyl 2-[4-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]phenyl]acetate (PubChem CID 87453472) has the molecular formula C31H43Cl2N5O5S and a molecular weight of 668.69 g/mol. Its IUPAC name is 2,5-dichlorobenzenesulfonic acid;4-(dimethylamino)butyl 2-[4-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]phenyl]acetate.
| Compound Name | 2,5-dichlorobenzenesulfonic acid;4-(dimethylamino)butyl 2-[4-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 87453472 |
| Molecular Formula | C31H43Cl2N5O5S |
| Molecular Weight | 668.69 g/mol |
| Exact Mass | 667.24 |
| IUPAC Name | 2,5-dichlorobenzenesulfonic acid;4-(dimethylamino)butyl 2-[4-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]phenyl]acetate |
| SMILES | CCCCCNc1nc(N)nc(C)c1Cc1ccc(CC(=O)OCCCCN(C)C)cc1.O=S(=O)(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C25H39N5O2.C6H4Cl2O3S/c1-5-6-7-14-27-24-22(19(2)28-25(26)29-24)17-20-10-12-21(13-11-20)18-23(31)32-16-9-8-15-30(3)4;7-4-1-2-5(8)6(3-4)12(9,10)11/h10-13H,5-9,14-18H2,1-4H3,(H3,26,27,28,29);1-3H,(H,9,10,11) |
| InChIKey | OWUJXRKNGBZAPH-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|