C22H32N4O3 — CID 146938923
2-[3-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2-methylpropanoic acid (PubChem CID 146938923) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[3-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 146938923 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-[3-[[2-amino-4-methyl-6-(pentylamino)pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2-methylpropanoic acid |
| SMILES | CCCCCNc1nc(N)nc(C)c1Cc1cc(C(C)(C)C(=O)O)ccc1OC |
| InChI | InChI=1S/C22H32N4O3/c1-6-7-8-11-24-19-17(14(2)25-21(23)26-19)13-15-12-16(9-10-18(15)29-5)22(3,4)20(27)28/h9-10,12H,6-8,11,13H2,1-5H3,(H,27,28)(H3,23,24,25,26) |
| InChIKey | AGMCHNBKZMLMQO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|