C19H24N4O3 — CID 134562936
(E)-3-[2-amino-6-(butylamino)-5-[(2-methoxyphenyl)methyl]pyrimidin-4-yl]prop-2-enoic acid (PubChem CID 134562936) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is (E)-3-[2-amino-6-(butylamino)-5-[(2-methoxyphenyl)methyl]pyrimidin-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-amino-6-(butylamino)-5-[(2-methoxyphenyl)methyl]pyrimidin-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134562936 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (E)-3-[2-amino-6-(butylamino)-5-[(2-methoxyphenyl)methyl]pyrimidin-4-yl]prop-2-enoic acid |
| SMILES | CCCCNc1nc(N)nc(/C=C/C(=O)O)c1Cc1ccccc1OC |
| InChI | InChI=1S/C19H24N4O3/c1-3-4-11-21-18-14(12-13-7-5-6-8-16(13)26-2)15(9-10-17(24)25)22-19(20)23-18/h5-10H,3-4,11-12H2,1-2H3,(H,24,25)(H3,20,21,22,23)/b10-9+ |
| InChIKey | MWWGCNCVVNHXEY-MDZDMXLPSA-N |
| XLogP | 2.97 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|