C18H26N4O2P+ — CID 134572360
[3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]-methyl-oxophosphanium (PubChem CID 134572360) has the molecular formula C18H26N4O2P+ and a molecular weight of 361.41 g/mol. Its IUPAC name is [3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]-methyl-oxophosphanium.
| Compound Name | [3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]-methyl-oxophosphanium |
|---|---|
| PubChem CID | 134572360 |
| Molecular Formula | C18H26N4O2P+ |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | [3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]-methyl-oxophosphanium |
| SMILES | CCCCNc1nc(N)nc(C)c1Cc1cc([P+](C)=O)ccc1OC |
| InChI | InChI=1S/C18H26N4O2P/c1-5-6-9-20-17-15(12(2)21-18(19)22-17)11-13-10-14(25(4)23)7-8-16(13)24-3/h7-8,10H,5-6,9,11H2,1-4H3,(H3,19,20,21,22)/q+1 |
| InChIKey | YTJHFHGHEIYORQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|