C20H29N5O5S — CID 134562768
2-[[3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxybenzoyl]amino]ethanesulfonic acid (PubChem CID 134562768) has the molecular formula C20H29N5O5S and a molecular weight of 451.55 g/mol. Its IUPAC name is 2-[[3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxybenzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxybenzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134562768 |
| Molecular Formula | C20H29N5O5S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[[3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxybenzoyl]amino]ethanesulfonic acid |
| SMILES | CCCCNc1nc(N)nc(C)c1Cc1cc(C(=O)NCCS(=O)(=O)O)ccc1OC |
| InChI | InChI=1S/C20H29N5O5S/c1-4-5-8-22-18-16(13(2)24-20(21)25-18)12-15-11-14(6-7-17(15)30-3)19(26)23-9-10-31(27,28)29/h6-7,11H,4-5,8-10,12H2,1-3H3,(H,23,26)(H,27,28,29)(H3,21,22,24,25) |
| InChIKey | XIJJYZJKBIFKFW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|