C24H36N5O7P — CID 134562883
(3S)-3-[[2-amino-5-[[2-methoxy-5-(3-phosphonopropylcarbamoyl)phenyl]methyl]-6-methylpyrimidin-4-yl]amino]heptanoic acid (PubChem CID 134562883) has the molecular formula C24H36N5O7P and a molecular weight of 537.55 g/mol. Its IUPAC name is (3S)-3-[[2-amino-5-[[2-methoxy-5-(3-phosphonopropylcarbamoyl)phenyl]methyl]-6-methylpyrimidin-4-yl]amino]heptanoic acid.
| Compound Name | (3S)-3-[[2-amino-5-[[2-methoxy-5-(3-phosphonopropylcarbamoyl)phenyl]methyl]-6-methylpyrimidin-4-yl]amino]heptanoic acid |
|---|---|
| PubChem CID | 134562883 |
| Molecular Formula | C24H36N5O7P |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | (3S)-3-[[2-amino-5-[[2-methoxy-5-(3-phosphonopropylcarbamoyl)phenyl]methyl]-6-methylpyrimidin-4-yl]amino]heptanoic acid |
| SMILES | CCCC[C@@H](CC(=O)O)Nc1nc(N)nc(C)c1Cc1cc(C(=O)NCCCP(=O)(O)O)ccc1OC |
| InChI | InChI=1S/C24H36N5O7P/c1-4-5-7-18(14-21(30)31)28-22-19(15(2)27-24(25)29-22)13-17-12-16(8-9-20(17)36-3)23(32)26-10-6-11-37(33,34)35/h8-9,12,18H,4-7,10-11,13-14H2,1-3H3,(H,26,32)(H,30,31)(H2,33,34,35)(H3,25,27,28,29)/t18-/m0/s1 |
| InChIKey | BUCBKQGKMDVFBE-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|