C12H18N2O5S — CID 163442773
2-[[4-methoxy-3-(methylaminomethyl)benzoyl]amino]ethanesulfonic acid (PubChem CID 163442773) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[[4-methoxy-3-(methylaminomethyl)benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-methoxy-3-(methylaminomethyl)benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 163442773 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[[4-methoxy-3-(methylaminomethyl)benzoyl]amino]ethanesulfonic acid |
| SMILES | CNCc1cc(C(=O)NCCS(=O)(=O)O)ccc1OC |
| InChI | InChI=1S/C12H18N2O5S/c1-13-8-10-7-9(3-4-11(10)19-2)12(15)14-5-6-20(16,17)18/h3-4,7,13H,5-6,8H2,1-2H3,(H,14,15)(H,16,17,18) |
| InChIKey | AZYAKHVEDJETDS-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|