C18H26N4O4P+ — CID 175327895
[3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]methoxy-hydroxy-oxophosphanium (PubChem CID 175327895) has the molecular formula C18H26N4O4P+ and a molecular weight of 393.40 g/mol. Its IUPAC name is [3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 175327895 |
| Molecular Formula | C18H26N4O4P+ |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [3-[[2-amino-4-(butylamino)-6-methylpyrimidin-5-yl]methyl]-4-methoxyphenyl]methoxy-hydroxy-oxophosphanium |
| SMILES | CCCCNc1nc(N)nc(C)c1Cc1cc(CO[P+](=O)O)ccc1OC |
| InChI | InChI=1S/C18H25N4O4P/c1-4-5-8-20-17-15(12(2)21-18(19)22-17)10-14-9-13(11-26-27(23)24)6-7-16(14)25-3/h6-7,9H,4-5,8,10-11H2,1-3H3,(H3-,19,20,21,22,23,24)/p+1 |
| InChIKey | OYSHIMSEXGITTK-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|