C21H30N8O — CID 134562866
4-N-butyl-5-[[2-methoxy-5-[2-(2H-tetrazol-5-yl)propan-2-yl]phenyl]methyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 134562866) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is 4-N-butyl-5-[[2-methoxy-5-[2-(2H-tetrazol-5-yl)propan-2-yl]phenyl]methyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-5-[[2-methoxy-5-[2-(2H-tetrazol-5-yl)propan-2-yl]phenyl]methyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134562866 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 4-N-butyl-5-[[2-methoxy-5-[2-(2H-tetrazol-5-yl)propan-2-yl]phenyl]methyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1nc(N)nc(C)c1Cc1cc(C(C)(C)c2nn[nH]n2)ccc1OC |
| InChI | InChI=1S/C21H30N8O/c1-6-7-10-23-18-16(13(2)24-20(22)25-18)12-14-11-15(8-9-17(14)30-5)21(3,4)19-26-28-29-27-19/h8-9,11H,6-7,10,12H2,1-5H3,(H3,22,23,24,25)(H,26,27,28,29) |
| InChIKey | RORFXKLXNHUCQQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|