C25H39N5O3 — CID 87444252
4-(dimethylamino)butyl 2-[4-[[2-amino-4-[hydroxy(pentan-2-yl)amino]-6-methylpyrimidin-5-yl]methyl]phenyl]acetate (PubChem CID 87444252) has the molecular formula C25H39N5O3 and a molecular weight of 457.62 g/mol. Its IUPAC name is 4-(dimethylamino)butyl 2-[4-[[2-amino-4-[hydroxy(pentan-2-yl)amino]-6-methylpyrimidin-5-yl]methyl]phenyl]acetate.
| Compound Name | 4-(dimethylamino)butyl 2-[4-[[2-amino-4-[hydroxy(pentan-2-yl)amino]-6-methylpyrimidin-5-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 87444252 |
| Molecular Formula | C25H39N5O3 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | 4-(dimethylamino)butyl 2-[4-[[2-amino-4-[hydroxy(pentan-2-yl)amino]-6-methylpyrimidin-5-yl]methyl]phenyl]acetate |
| SMILES | CCCC(C)N(O)c1nc(N)nc(C)c1Cc1ccc(CC(=O)OCCCCN(C)C)cc1 |
| InChI | InChI=1S/C25H39N5O3/c1-6-9-18(2)30(32)24-22(19(3)27-25(26)28-24)16-20-10-12-21(13-11-20)17-23(31)33-15-8-7-14-29(4)5/h10-13,18,32H,6-9,14-17H2,1-5H3,(H2,26,27,28) |
| InChIKey | SDNMWENRTZPXIB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|