C22H31FN4O3 — CID 87444824
ethyl 2-[4-[[2-amino-4-[hexan-3-yl(hydroxy)amino]-6-methylpyrimidin-5-yl]methyl]-3-fluorophenyl]acetate (PubChem CID 87444824) has the molecular formula C22H31FN4O3 and a molecular weight of 418.51 g/mol. Its IUPAC name is ethyl 2-[4-[[2-amino-4-[hexan-3-yl(hydroxy)amino]-6-methylpyrimidin-5-yl]methyl]-3-fluorophenyl]acetate.
| Compound Name | ethyl 2-[4-[[2-amino-4-[hexan-3-yl(hydroxy)amino]-6-methylpyrimidin-5-yl]methyl]-3-fluorophenyl]acetate |
|---|---|
| PubChem CID | 87444824 |
| Molecular Formula | C22H31FN4O3 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | ethyl 2-[4-[[2-amino-4-[hexan-3-yl(hydroxy)amino]-6-methylpyrimidin-5-yl]methyl]-3-fluorophenyl]acetate |
| SMILES | CCCC(CC)N(O)c1nc(N)nc(C)c1Cc1ccc(CC(=O)OCC)cc1F |
| InChI | InChI=1S/C22H31FN4O3/c1-5-8-17(6-2)27(29)21-18(14(4)25-22(24)26-21)13-16-10-9-15(11-19(16)23)12-20(28)30-7-3/h9-11,17,29H,5-8,12-13H2,1-4H3,(H2,24,25,26) |
| InChIKey | WKLUWNKAWGSIOI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|