C26H41N5O3 — CID 71179171
2-[4-[[2-amino-4-(1-hydroxyhexan-3-ylamino)-6-methylpyrimidin-5-yl]methyl]phenyl]-6-(dimethylamino)hexanoic acid (PubChem CID 71179171) has the molecular formula C26H41N5O3 and a molecular weight of 471.65 g/mol. Its IUPAC name is 2-[4-[[2-amino-4-(1-hydroxyhexan-3-ylamino)-6-methylpyrimidin-5-yl]methyl]phenyl]-6-(dimethylamino)hexanoic acid.
| Compound Name | 2-[4-[[2-amino-4-(1-hydroxyhexan-3-ylamino)-6-methylpyrimidin-5-yl]methyl]phenyl]-6-(dimethylamino)hexanoic acid |
|---|---|
| PubChem CID | 71179171 |
| Molecular Formula | C26H41N5O3 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 2-[4-[[2-amino-4-(1-hydroxyhexan-3-ylamino)-6-methylpyrimidin-5-yl]methyl]phenyl]-6-(dimethylamino)hexanoic acid |
| SMILES | CCCC(CCO)Nc1nc(N)nc(C)c1Cc1ccc(C(CCCCN(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C26H41N5O3/c1-5-8-21(14-16-32)29-24-23(18(2)28-26(27)30-24)17-19-10-12-20(13-11-19)22(25(33)34)9-6-7-15-31(3)4/h10-13,21-22,32H,5-9,14-17H2,1-4H3,(H,33,34)(H3,27,28,29,30) |
| InChIKey | TYHURAOUCMQKBY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|