C18H15N5OS2 — CID 134574579
2-[methyl(methylsulfanyl)amino]-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carbaldehyde (PubChem CID 134574579) has the molecular formula C18H15N5OS2 and a molecular weight of 381.49 g/mol. Its IUPAC name is 2-[methyl(methylsulfanyl)amino]-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carbaldehyde.
| Compound Name | 2-[methyl(methylsulfanyl)amino]-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 134574579 |
| Molecular Formula | C18H15N5OS2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-[methyl(methylsulfanyl)amino]-6-(5-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)pyridine-4-carbaldehyde |
| SMILES | CSN(C)c1cc(C=O)cc(-c2cnn3ccc(-c4cccs4)nc23)n1 |
| InChI | InChI=1S/C18H15N5OS2/c1-22(25-2)17-9-12(11-24)8-15(20-17)13-10-19-23-6-5-14(21-18(13)23)16-4-3-7-26-16/h3-11H,1-2H3 |
| InChIKey | QETNILDLVQOPKK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|