C20H27FN2O2 — CID 134574710
(3R,6S,7R,8aS)-7-tert-butyl-6-(4-fluorophenyl)-2,3,7-trimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 134574710) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is (3R,6S,7R,8aS)-7-tert-butyl-6-(4-fluorophenyl)-2,3,7-trimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3R,6S,7R,8aS)-7-tert-butyl-6-(4-fluorophenyl)-2,3,7-trimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 134574710 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3R,6S,7R,8aS)-7-tert-butyl-6-(4-fluorophenyl)-2,3,7-trimethyl-3,6,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | C[C@@H]1C(=O)N2[C@@H](c3ccc(F)cc3)[C@@](C)(C(C)(C)C)C[C@H]2C(=O)N1C |
| InChI | InChI=1S/C20H27FN2O2/c1-12-17(24)23-15(18(25)22(12)6)11-20(5,19(2,3)4)16(23)13-7-9-14(21)10-8-13/h7-10,12,15-16H,11H2,1-6H3/t12-,15+,16+,20+/m1/s1 |
| InChIKey | CEBJCFLGZIFXGJ-MPBUKGMASA-N |
| XLogP | 3.38 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |