About ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate
ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate (PubChem CID 134575994) has the molecular formula C14H26N2O4
and a molecular weight of 286.37 g/mol. Its IUPAC name is ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate.
Analyze ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate?
The IUPAC name of ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate (CID 134575994) is ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate.
What is the SMILES notation for ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate?
The canonical SMILES for ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate is CCCCN(C(=O)OCC)N1CCC2(CC1)OCCO2.
What is the InChIKey of ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate?
The InChIKey is HBYAUQVGRZQKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O4/c1-3-5-8-16(13(17)18-4-2)15-9-6-14(7-10-15)19-11-12-20-14/h3-12H2,1-2H3.
What are the key properties of ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate?
ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate has a molecular weight of 286.37 g/mol, XLogP of 2.00, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-butyl-N-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)carbamate is sourced from PubChem (CID 134575994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).