C11H21NO4S — CID 17377912
8-butylsulfonyl-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 17377912) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 8-butylsulfonyl-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 8-butylsulfonyl-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 17377912 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 8-butylsulfonyl-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCCCS(=O)(=O)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H21NO4S/c1-2-3-10-17(13,14)12-6-4-11(5-7-12)15-8-9-16-11/h2-10H2,1H3 |
| InChIKey | CKQFKXPJRVJRIO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |