C18H35NO6S — CID 102324781
[3-(hydroxymethyl)-9-octylsulfonyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methanol (PubChem CID 102324781) has the molecular formula C18H35NO6S and a molecular weight of 393.55 g/mol. Its IUPAC name is [3-(hydroxymethyl)-9-octylsulfonyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methanol.
| Compound Name | [3-(hydroxymethyl)-9-octylsulfonyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methanol |
|---|---|
| PubChem CID | 102324781 |
| Molecular Formula | C18H35NO6S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [3-(hydroxymethyl)-9-octylsulfonyl-1,5-dioxa-9-azaspiro[5.5]undecan-3-yl]methanol |
| SMILES | CCCCCCCCS(=O)(=O)N1CCC2(CC1)OCC(CO)(CO)CO2 |
| InChI | InChI=1S/C18H35NO6S/c1-2-3-4-5-6-7-12-26(22,23)19-10-8-18(9-11-19)24-15-17(13-20,14-21)16-25-18/h20-21H,2-16H2,1H3 |
| InChIKey | OXDRAPGYTXSRTO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|