C16H29ClN6O3 — CID 134577718
2-amino-6-chloro-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 134577718) has the molecular formula C16H29ClN6O3 and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-chloro-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 134577718 |
| Molecular Formula | C16H29ClN6O3 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-amino-6-chloro-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC1NN2CC(Cl)CNC2C1C(=O)NC1CNCCC1O[C@@H]1CCOC1 |
| InChI | InChI=1S/C16H29ClN6O3/c17-9-5-20-15-13(14(18)22-23(15)7-9)16(24)21-11-6-19-3-1-12(11)26-10-2-4-25-8-10/h9-15,19-20,22H,1-8,18H2,(H,21,24)/t9?,10-,11?,12?,13?,14?,15?/m1/s1 |
| InChIKey | ZCBWGKDDUPTMGF-WLRBYXKJSA-N |
| XLogP | -2.10 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|